C17H25ClN4O2 — CID 119657464
N-(3-amino-4-methylpentyl)-N-methyl-2-(1-oxophthalazin-2-yl)acetamide;hydrochloride (PubChem CID 119657464) has the molecular formula C17H25ClN4O2 and a molecular weight of 352.87 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-N-methyl-2-(1-oxophthalazin-2-yl)acetamide;hydrochloride.
| Compound Name | N-(3-amino-4-methylpentyl)-N-methyl-2-(1-oxophthalazin-2-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119657464 |
| Molecular Formula | C17H25ClN4O2 |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-N-methyl-2-(1-oxophthalazin-2-yl)acetamide;hydrochloride |
| SMILES | CC(C)C(N)CCN(C)C(=O)Cn1ncc2ccccc2c1=O.Cl |
| InChI | InChI=1S/C17H24N4O2.ClH/c1-12(2)15(18)8-9-20(3)16(22)11-21-17(23)14-7-5-4-6-13(14)10-19-21;/h4-7,10,12,15H,8-9,11,18H2,1-3H3;1H |
| InChIKey | JKUCMTUZGZDWEM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |