C21H25N3O2 — CID 86930822
N-(2-adamantyl)-N-methyl-2-(1-oxophthalazin-2-yl)acetamide (PubChem CID 86930822) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is N-(2-adamantyl)-N-methyl-2-(1-oxophthalazin-2-yl)acetamide.
| Compound Name | N-(2-adamantyl)-N-methyl-2-(1-oxophthalazin-2-yl)acetamide |
|---|---|
| PubChem CID | 86930822 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | N-(2-adamantyl)-N-methyl-2-(1-oxophthalazin-2-yl)acetamide |
| SMILES | CN(C(=O)Cn1ncc2ccccc2c1=O)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C21H25N3O2/c1-23(20-16-7-13-6-14(9-16)10-17(20)8-13)19(25)12-24-21(26)18-5-3-2-4-15(18)11-22-24/h2-5,11,13-14,16-17,20H,6-10,12H2,1H3 |
| InChIKey | VQAWPLIRTAGJKH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |