C19H31N3O2S — CID 119657829
N-(3-amino-4-methylpentyl)-N-methyl-2-[2-oxo-2-(propan-2-ylamino)ethyl]sulfanylbenzamide (PubChem CID 119657829) has the molecular formula C19H31N3O2S and a molecular weight of 365.54 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-N-methyl-2-[2-oxo-2-(propan-2-ylamino)ethyl]sulfanylbenzamide.
| Compound Name | N-(3-amino-4-methylpentyl)-N-methyl-2-[2-oxo-2-(propan-2-ylamino)ethyl]sulfanylbenzamide |
|---|---|
| PubChem CID | 119657829 |
| Molecular Formula | C19H31N3O2S |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-N-methyl-2-[2-oxo-2-(propan-2-ylamino)ethyl]sulfanylbenzamide |
| SMILES | CC(C)NC(=O)CSc1ccccc1C(=O)N(C)CCC(N)C(C)C |
| InChI | InChI=1S/C19H31N3O2S/c1-13(2)16(20)10-11-22(5)19(24)15-8-6-7-9-17(15)25-12-18(23)21-14(3)4/h6-9,13-14,16H,10-12,20H2,1-5H3,(H,21,23) |
| InChIKey | GIWJGXHVEISFRR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |