C19H26N2OS2 — CID 119659075
N-(3-amino-4-methylpentyl)-N-methyl-2-(thiophen-2-ylmethylsulfanyl)benzamide (PubChem CID 119659075) has the molecular formula C19H26N2OS2 and a molecular weight of 362.56 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-N-methyl-2-(thiophen-2-ylmethylsulfanyl)benzamide.
| Compound Name | N-(3-amino-4-methylpentyl)-N-methyl-2-(thiophen-2-ylmethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 119659075 |
| Molecular Formula | C19H26N2OS2 |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-N-methyl-2-(thiophen-2-ylmethylsulfanyl)benzamide |
| SMILES | CC(C)C(N)CCN(C)C(=O)c1ccccc1SCc1cccs1 |
| InChI | InChI=1S/C19H26N2OS2/c1-14(2)17(20)10-11-21(3)19(22)16-8-4-5-9-18(16)24-13-15-7-6-12-23-15/h4-9,12,14,17H,10-11,13,20H2,1-3H3 |
| InChIKey | JLWKBRNBISGFEO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |