C14H26ClN5O3 — CID 119660238
N-(3-amino-4-methylpentyl)-N-methyl-4-nitro-5-propyl-1H-pyrazole-3-carboxamide;hydrochloride (PubChem CID 119660238) has the molecular formula C14H26ClN5O3 and a molecular weight of 347.85 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-N-methyl-4-nitro-5-propyl-1H-pyrazole-3-carboxamide;hydrochloride.
| Compound Name | N-(3-amino-4-methylpentyl)-N-methyl-4-nitro-5-propyl-1H-pyrazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119660238 |
| Molecular Formula | C14H26ClN5O3 |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-N-methyl-4-nitro-5-propyl-1H-pyrazole-3-carboxamide;hydrochloride |
| SMILES | CCCc1[nH]nc(C(=O)N(C)CCC(N)C(C)C)c1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C14H25N5O3.ClH/c1-5-6-11-13(19(21)22)12(17-16-11)14(20)18(4)8-7-10(15)9(2)3;/h9-10H,5-8,15H2,1-4H3,(H,16,17);1H |
| InChIKey | LKYHSNFLARUTCR-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 118.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|