C12H20ClN3O4 — CID 119658346
N-(3-amino-4-methylpentyl)-N-methyl-5-nitrofuran-2-carboxamide;hydrochloride (PubChem CID 119658346) has the molecular formula C12H20ClN3O4 and a molecular weight of 305.76 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-N-methyl-5-nitrofuran-2-carboxamide;hydrochloride.
| Compound Name | N-(3-amino-4-methylpentyl)-N-methyl-5-nitrofuran-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119658346 |
| Molecular Formula | C12H20ClN3O4 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-N-methyl-5-nitrofuran-2-carboxamide;hydrochloride |
| SMILES | CC(C)C(N)CCN(C)C(=O)c1ccc([N+](=O)[O-])o1.Cl |
| InChI | InChI=1S/C12H19N3O4.ClH/c1-8(2)9(13)6-7-14(3)12(16)10-4-5-11(19-10)15(17)18;/h4-5,8-9H,6-7,13H2,1-3H3;1H |
| InChIKey | PEVIQJDZBGPKJL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 102.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|