C18H23ClN2O2 — CID 119658454
N-(3-amino-4-methylpentyl)-5-(2-chlorophenyl)-N-methylfuran-2-carboxamide (PubChem CID 119658454) has the molecular formula C18H23ClN2O2 and a molecular weight of 334.85 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-5-(2-chlorophenyl)-N-methylfuran-2-carboxamide.
| Compound Name | N-(3-amino-4-methylpentyl)-5-(2-chlorophenyl)-N-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 119658454 |
| Molecular Formula | C18H23ClN2O2 |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-5-(2-chlorophenyl)-N-methylfuran-2-carboxamide |
| SMILES | CC(C)C(N)CCN(C)C(=O)c1ccc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C18H23ClN2O2/c1-12(2)15(20)10-11-21(3)18(22)17-9-8-16(23-17)13-6-4-5-7-14(13)19/h4-9,12,15H,10-11,20H2,1-3H3 |
| InChIKey | PVASMCRAYFOZOP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |