C13H23ClN2O2S — CID 119658758
N-(3-amino-4-methylpentyl)-N-methyl-5-methylsulfanylfuran-2-carboxamide;hydrochloride (PubChem CID 119658758) has the molecular formula C13H23ClN2O2S and a molecular weight of 306.86 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-N-methyl-5-methylsulfanylfuran-2-carboxamide;hydrochloride.
| Compound Name | N-(3-amino-4-methylpentyl)-N-methyl-5-methylsulfanylfuran-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119658758 |
| Molecular Formula | C13H23ClN2O2S |
| Molecular Weight | 306.86 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-N-methyl-5-methylsulfanylfuran-2-carboxamide;hydrochloride |
| SMILES | CSc1ccc(C(=O)N(C)CCC(N)C(C)C)o1.Cl |
| InChI | InChI=1S/C13H22N2O2S.ClH/c1-9(2)10(14)7-8-15(3)13(16)11-5-6-12(17-11)18-4;/h5-6,9-10H,7-8,14H2,1-4H3;1H |
| InChIKey | HDXJEERGCVTJQG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.86 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |