C14H25N3O4S — CID 119660341
N-(3-amino-4-methylpentyl)-5-(methanesulfonamidomethyl)-N-methylfuran-2-carboxamide (PubChem CID 119660341) has the molecular formula C14H25N3O4S and a molecular weight of 331.44 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-5-(methanesulfonamidomethyl)-N-methylfuran-2-carboxamide.
| Compound Name | N-(3-amino-4-methylpentyl)-5-(methanesulfonamidomethyl)-N-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 119660341 |
| Molecular Formula | C14H25N3O4S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-5-(methanesulfonamidomethyl)-N-methylfuran-2-carboxamide |
| SMILES | CC(C)C(N)CCN(C)C(=O)c1ccc(CNS(C)(=O)=O)o1 |
| InChI | InChI=1S/C14H25N3O4S/c1-10(2)12(15)7-8-17(3)14(18)13-6-5-11(21-13)9-16-22(4,19)20/h5-6,10,12,16H,7-9,15H2,1-4H3 |
| InChIKey | BZHMBNNYIIKRAA-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |