C19H27ClN4O4 — CID 119662095
7-[4-(3-aminopropoxy)piperidine-1-carbonyl]-3-ethyl-1H-quinazoline-2,4-dione;hydrochloride (PubChem CID 119662095) has the molecular formula C19H27ClN4O4 and a molecular weight of 410.90 g/mol. Its IUPAC name is 7-[4-(3-aminopropoxy)piperidine-1-carbonyl]-3-ethyl-1H-quinazoline-2,4-dione;hydrochloride.
| Compound Name | 7-[4-(3-aminopropoxy)piperidine-1-carbonyl]-3-ethyl-1H-quinazoline-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 119662095 |
| Molecular Formula | C19H27ClN4O4 |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 7-[4-(3-aminopropoxy)piperidine-1-carbonyl]-3-ethyl-1H-quinazoline-2,4-dione;hydrochloride |
| SMILES | CCn1c(=O)[nH]c2cc(C(=O)N3CCC(OCCCN)CC3)ccc2c1=O.Cl |
| InChI | InChI=1S/C19H26N4O4.ClH/c1-2-23-18(25)15-5-4-13(12-16(15)21-19(23)26)17(24)22-9-6-14(7-10-22)27-11-3-8-20;/h4-5,12,14H,2-3,6-11,20H2,1H3,(H,21,26);1H |
| InChIKey | WSZNZQIEQNKDPK-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 110.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|