C18H24N4O4 — CID 119663753
3-[2-[4-(3-aminopropoxy)piperidin-1-yl]-2-oxoethyl]-1H-quinazoline-2,4-dione (PubChem CID 119663753) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is 3-[2-[4-(3-aminopropoxy)piperidin-1-yl]-2-oxoethyl]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[2-[4-(3-aminopropoxy)piperidin-1-yl]-2-oxoethyl]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 119663753 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 3-[2-[4-(3-aminopropoxy)piperidin-1-yl]-2-oxoethyl]-1H-quinazoline-2,4-dione |
| SMILES | NCCCOC1CCN(C(=O)Cn2c(=O)[nH]c3ccccc3c2=O)CC1 |
| InChI | InChI=1S/C18H24N4O4/c19-8-3-11-26-13-6-9-21(10-7-13)16(23)12-22-17(24)14-4-1-2-5-15(14)20-18(22)25/h1-2,4-5,13H,3,6-12,19H2,(H,20,25) |
| InChIKey | UPFIEHZYKHSHKR-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 110.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|