C23H28ClN3O3 — CID 119662758
10-[2-[4-(3-aminopropoxy)piperidin-1-yl]-2-oxoethyl]acridin-9-one;hydrochloride (PubChem CID 119662758) has the molecular formula C23H28ClN3O3 and a molecular weight of 429.95 g/mol. Its IUPAC name is 10-[2-[4-(3-aminopropoxy)piperidin-1-yl]-2-oxoethyl]acridin-9-one;hydrochloride.
| Compound Name | 10-[2-[4-(3-aminopropoxy)piperidin-1-yl]-2-oxoethyl]acridin-9-one;hydrochloride |
|---|---|
| PubChem CID | 119662758 |
| Molecular Formula | C23H28ClN3O3 |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 10-[2-[4-(3-aminopropoxy)piperidin-1-yl]-2-oxoethyl]acridin-9-one;hydrochloride |
| SMILES | Cl.NCCCOC1CCN(C(=O)Cn2c3ccccc3c(=O)c3ccccc32)CC1 |
| InChI | InChI=1S/C23H27N3O3.ClH/c24-12-5-15-29-17-10-13-25(14-11-17)22(27)16-26-20-8-3-1-6-18(20)23(28)19-7-2-4-9-21(19)26;/h1-4,6-9,17H,5,10-16,24H2;1H |
| InChIKey | VMMQLNNVLVXOAO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 77.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|