C20H32N2O3 — CID 119662243
1-[4-(3-aminopropoxy)piperidin-1-yl]-3-(2,3,5-trimethylphenoxy)propan-1-one (PubChem CID 119662243) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is 1-[4-(3-aminopropoxy)piperidin-1-yl]-3-(2,3,5-trimethylphenoxy)propan-1-one.
| Compound Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-3-(2,3,5-trimethylphenoxy)propan-1-one |
|---|---|
| PubChem CID | 119662243 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-3-(2,3,5-trimethylphenoxy)propan-1-one |
| SMILES | Cc1cc(C)c(C)c(OCCC(=O)N2CCC(OCCCN)CC2)c1 |
| InChI | InChI=1S/C20H32N2O3/c1-15-13-16(2)17(3)19(14-15)25-12-7-20(23)22-9-5-18(6-10-22)24-11-4-8-21/h13-14,18H,4-12,21H2,1-3H3 |
| InChIKey | VEWAXMAPYIXGEU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|