C16H21N3O3S — CID 119663063
[4-(3-aminopropoxy)piperidin-1-yl]-[2-(furan-2-yl)-1,3-thiazol-5-yl]methanone (PubChem CID 119663063) has the molecular formula C16H21N3O3S and a molecular weight of 335.43 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-[2-(furan-2-yl)-1,3-thiazol-5-yl]methanone.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-[2-(furan-2-yl)-1,3-thiazol-5-yl]methanone |
|---|---|
| PubChem CID | 119663063 |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-[2-(furan-2-yl)-1,3-thiazol-5-yl]methanone |
| SMILES | NCCCOC1CCN(C(=O)c2cnc(-c3ccco3)s2)CC1 |
| InChI | InChI=1S/C16H21N3O3S/c17-6-2-10-21-12-4-7-19(8-5-12)16(20)14-11-18-15(23-14)13-3-1-9-22-13/h1,3,9,11-12H,2,4-8,10,17H2 |
| InChIKey | TZZBRVDRNIXAAG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|