C23H29FN2O2 — CID 119663065
[4-(3-aminopropoxy)piperidin-1-yl]-[4-(3,4-dimethylphenyl)-2-fluorophenyl]methanone (PubChem CID 119663065) has the molecular formula C23H29FN2O2 and a molecular weight of 384.50 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-[4-(3,4-dimethylphenyl)-2-fluorophenyl]methanone.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-[4-(3,4-dimethylphenyl)-2-fluorophenyl]methanone |
|---|---|
| PubChem CID | 119663065 |
| Molecular Formula | C23H29FN2O2 |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-[4-(3,4-dimethylphenyl)-2-fluorophenyl]methanone |
| SMILES | Cc1ccc(-c2ccc(C(=O)N3CCC(OCCCN)CC3)c(F)c2)cc1C |
| InChI | InChI=1S/C23H29FN2O2/c1-16-4-5-18(14-17(16)2)19-6-7-21(22(24)15-19)23(27)26-11-8-20(9-12-26)28-13-3-10-25/h4-7,14-15,20H,3,8-13,25H2,1-2H3 |
| InChIKey | JOVWHTOIRYPFEQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|