C17H25ClN4O2 — CID 119663151
1-[4-(3-aminopropoxy)piperidin-1-yl]-2-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone;hydrochloride (PubChem CID 119663151) has the molecular formula C17H25ClN4O2 and a molecular weight of 352.87 g/mol. Its IUPAC name is 1-[4-(3-aminopropoxy)piperidin-1-yl]-2-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone;hydrochloride.
| Compound Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-2-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 119663151 |
| Molecular Formula | C17H25ClN4O2 |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-2-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone;hydrochloride |
| SMILES | Cl.NCCCOC1CCN(C(=O)Cc2c[nH]c3ncccc23)CC1 |
| InChI | InChI=1S/C17H24N4O2.ClH/c18-6-2-10-23-14-4-8-21(9-5-14)16(22)11-13-12-20-17-15(13)3-1-7-19-17;/h1,3,7,12,14H,2,4-6,8-11,18H2,(H,19,20);1H |
| InChIKey | JEWRTSHXGXLYAK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|