C18H24F2N2O2 — CID 119664731
[4-(3-aminopropoxy)piperidin-1-yl]-[2-(2,3-difluorophenyl)cyclopropyl]methanone (PubChem CID 119664731) has the molecular formula C18H24F2N2O2 and a molecular weight of 338.40 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-[2-(2,3-difluorophenyl)cyclopropyl]methanone.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-[2-(2,3-difluorophenyl)cyclopropyl]methanone |
|---|---|
| PubChem CID | 119664731 |
| Molecular Formula | C18H24F2N2O2 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-[2-(2,3-difluorophenyl)cyclopropyl]methanone |
| SMILES | NCCCOC1CCN(C(=O)C2CC2c2cccc(F)c2F)CC1 |
| InChI | InChI=1S/C18H24F2N2O2/c19-16-4-1-3-13(17(16)20)14-11-15(14)18(23)22-8-5-12(6-9-22)24-10-2-7-21/h1,3-4,12,14-15H,2,5-11,21H2 |
| InChIKey | ZHNYYMDRVIAMQJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|