C15H26N2O2 — CID 124596715
[4-(3-aminopropoxy)piperidin-1-yl]-[(1S,2R)-2-cyclopropylcyclopropyl]methanone (PubChem CID 124596715) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-[(1S,2R)-2-cyclopropylcyclopropyl]methanone.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-[(1S,2R)-2-cyclopropylcyclopropyl]methanone |
|---|---|
| PubChem CID | 124596715 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-[(1S,2R)-2-cyclopropylcyclopropyl]methanone |
| SMILES | NCCCOC1CCN(C(=O)[C@H]2C[C@@H]2C2CC2)CC1 |
| InChI | InChI=1S/C15H26N2O2/c16-6-1-9-19-12-4-7-17(8-5-12)15(18)14-10-13(14)11-2-3-11/h11-14H,1-10,16H2/t13-,14+/m1/s1 |
| InChIKey | LXDLGKMGMPMLBH-KGLIPLIRSA-N |
| XLogP | 1.39 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|