C12H23N5O3S — CID 119667308
N-(1-aminohexan-2-yl)-2-[(1-methylimidazol-4-yl)sulfonylamino]acetamide (PubChem CID 119667308) has the molecular formula C12H23N5O3S and a molecular weight of 317.42 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-2-[(1-methylimidazol-4-yl)sulfonylamino]acetamide.
| Compound Name | N-(1-aminohexan-2-yl)-2-[(1-methylimidazol-4-yl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 119667308 |
| Molecular Formula | C12H23N5O3S |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | N-(1-aminohexan-2-yl)-2-[(1-methylimidazol-4-yl)sulfonylamino]acetamide |
| SMILES | CCCCC(CN)NC(=O)CNS(=O)(=O)c1cn(C)cn1 |
| InChI | InChI=1S/C12H23N5O3S/c1-3-4-5-10(6-13)16-11(18)7-15-21(19,20)12-8-17(2)9-14-12/h8-10,15H,3-7,13H2,1-2H3,(H,16,18) |
| InChIKey | FHJFALJYZUVKLH-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |