C17H27ClN2O — CID 119667796
N-(1-aminohexan-2-yl)-2-(2-methylphenyl)cyclopropane-1-carboxamide;hydrochloride (PubChem CID 119667796) has the molecular formula C17H27ClN2O and a molecular weight of 310.87 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-2-(2-methylphenyl)cyclopropane-1-carboxamide;hydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-2-(2-methylphenyl)cyclopropane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119667796 |
| Molecular Formula | C17H27ClN2O |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | N-(1-aminohexan-2-yl)-2-(2-methylphenyl)cyclopropane-1-carboxamide;hydrochloride |
| SMILES | CCCCC(CN)NC(=O)C1CC1c1ccccc1C.Cl |
| InChI | InChI=1S/C17H26N2O.ClH/c1-3-4-8-13(11-18)19-17(20)16-10-15(16)14-9-6-5-7-12(14)2;/h5-7,9,13,15-16H,3-4,8,10-11,18H2,1-2H3,(H,19,20);1H |
| InChIKey | RNXBAXGQHBNQPN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |