C17H20F3NO4 — CID 120615374
(2S)-2-[[2-[2-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]hexanoic acid (PubChem CID 120615374) has the molecular formula C17H20F3NO4 and a molecular weight of 359.34 g/mol. Its IUPAC name is (2S)-2-[[2-[2-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]hexanoic acid.
| Compound Name | (2S)-2-[[2-[2-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 120615374 |
| Molecular Formula | C17H20F3NO4 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | (2S)-2-[[2-[2-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)C1CC1c1ccccc1OC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C17H20F3NO4/c1-2-3-7-13(16(23)24)21-15(22)12-9-11(12)10-6-4-5-8-14(10)25-17(18,19)20/h4-6,8,11-13H,2-3,7,9H2,1H3,(H,21,22)(H,23,24)/t11?,12?,13-/m0/s1 |
| InChIKey | HFGFOYRNXLTNCL-BPCQOVAHSA-N |
| XLogP | 3.45 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |