About 3-[methyl-[(1S,2R)-2-[2-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]propanoic acid
3-[methyl-[(1S,2R)-2-[2-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]propanoic acid (PubChem CID 124686690) has the molecular formula C15H16F3NO4
and a molecular weight of 331.29 g/mol. Its IUPAC name is 3-[methyl-[(1S,2R)-2-[2-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]propanoic acid.
Molecular Properties
| Compound Name | 3-[methyl-[(1S,2R)-2-[2-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]propanoic acid |
| PubChem CID | 124686690 |
| Molecular Formula | C15H16F3NO4 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 3-[methyl-[(1S,2R)-2-[2-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]propanoic acid |
| SMILES | CN(CCC(=O)O)C(=O)[C@H]1C[C@H]1c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C15H16F3NO4/c1-19(7-6-13(20)21)14(22)11-8-10(11)9-4-2-3-5-12(9)23-15(16,17)18/h2-5,10-11H,6-8H2,1H3,(H,20,21)/t10-,11-/m0/s1 |
| InChIKey | SHUAXTWABVUPTH-QWRGUYRKSA-N |
| XLogP | 2.62 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[methyl-[(1S,2R)-2-[2-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[methyl-[(1S,2R)-2-[2-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]propanoic acid?
The IUPAC name of 3-[methyl-[(1S,2R)-2-[2-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]propanoic acid (CID 124686690) is 3-[methyl-[(1S,2R)-2-[2-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]propanoic acid.
What is the SMILES notation for 3-[methyl-[(1S,2R)-2-[2-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]propanoic acid?
The canonical SMILES for 3-[methyl-[(1S,2R)-2-[2-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]propanoic acid is CN(CCC(=O)O)C(=O)[C@H]1C[C@H]1c1ccccc1OC(F)(F)F.
What is the InChIKey of 3-[methyl-[(1S,2R)-2-[2-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]propanoic acid?
The InChIKey is SHUAXTWABVUPTH-QWRGUYRKSA-N. The full InChI is InChI=1S/C15H16F3NO4/c1-19(7-6-13(20)21)14(22)11-8-10(11)9-4-2-3-5-12(9)23-15(16,17)18/h2-5,10-11H,6-8H2,1H3,(H,20,21)/t10-,11-/m0/s1.
What are the key properties of 3-[methyl-[(1S,2R)-2-[2-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]propanoic acid?
3-[methyl-[(1S,2R)-2-[2-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]propanoic acid has a molecular weight of 331.29 g/mol, XLogP of 2.62, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[methyl-[(1S,2R)-2-[2-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]propanoic acid is sourced from PubChem (CID 124686690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).