About 2-[oxan-4-yl-[(1R,2S)-2-[2-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]acetic acid
2-[oxan-4-yl-[(1R,2S)-2-[2-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]acetic acid (PubChem CID 125151976) has the molecular formula C18H20F3NO5
and a molecular weight of 387.35 g/mol. Its IUPAC name is 2-[oxan-4-yl-[(1R,2S)-2-[2-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]acetic acid.
Molecular Properties
| Compound Name | 2-[oxan-4-yl-[(1R,2S)-2-[2-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]acetic acid |
| PubChem CID | 125151976 |
| Molecular Formula | C18H20F3NO5 |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 2-[oxan-4-yl-[(1R,2S)-2-[2-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]acetic acid |
| SMILES | O=C(O)CN(C(=O)[C@@H]1C[C@@H]1c1ccccc1OC(F)(F)F)C1CCOCC1 |
| InChI | InChI=1S/C18H20F3NO5/c19-18(20,21)27-15-4-2-1-3-12(15)13-9-14(13)17(25)22(10-16(23)24)11-5-7-26-8-6-11/h1-4,11,13-14H,5-10H2,(H,23,24)/t13-,14-/m1/s1 |
| InChIKey | MJVTXIDMEZMDCM-ZIAGYGMSSA-N |
| XLogP | 2.78 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[oxan-4-yl-[(1R,2S)-2-[2-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[oxan-4-yl-[(1R,2S)-2-[2-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]acetic acid?
The IUPAC name of 2-[oxan-4-yl-[(1R,2S)-2-[2-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]acetic acid (CID 125151976) is 2-[oxan-4-yl-[(1R,2S)-2-[2-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]acetic acid.
What is the SMILES notation for 2-[oxan-4-yl-[(1R,2S)-2-[2-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]acetic acid?
The canonical SMILES for 2-[oxan-4-yl-[(1R,2S)-2-[2-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]acetic acid is O=C(O)CN(C(=O)[C@@H]1C[C@@H]1c1ccccc1OC(F)(F)F)C1CCOCC1.
What is the InChIKey of 2-[oxan-4-yl-[(1R,2S)-2-[2-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]acetic acid?
The InChIKey is MJVTXIDMEZMDCM-ZIAGYGMSSA-N. The full InChI is InChI=1S/C18H20F3NO5/c19-18(20,21)27-15-4-2-1-3-12(15)13-9-14(13)17(25)22(10-16(23)24)11-5-7-26-8-6-11/h1-4,11,13-14H,5-10H2,(H,23,24)/t13-,14-/m1/s1.
What are the key properties of 2-[oxan-4-yl-[(1R,2S)-2-[2-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]acetic acid?
2-[oxan-4-yl-[(1R,2S)-2-[2-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]acetic acid has a molecular weight of 387.35 g/mol, XLogP of 2.78, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[oxan-4-yl-[(1R,2S)-2-[2-(trifluoromethoxy)phenyl]cyclopropanecarbonyl]amino]acetic acid is sourced from PubChem (CID 125151976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).