C16H27N3O — CID 119668833
N-(1-aminohexan-2-yl)-2-(2,6-dimethylanilino)acetamide (PubChem CID 119668833) has the molecular formula C16H27N3O and a molecular weight of 277.41 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-2-(2,6-dimethylanilino)acetamide.
| Compound Name | N-(1-aminohexan-2-yl)-2-(2,6-dimethylanilino)acetamide |
|---|---|
| PubChem CID | 119668833 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | N-(1-aminohexan-2-yl)-2-(2,6-dimethylanilino)acetamide |
| SMILES | CCCCC(CN)NC(=O)CNc1c(C)cccc1C |
| InChI | InChI=1S/C16H27N3O/c1-4-5-9-14(10-17)19-15(20)11-18-16-12(2)7-6-8-13(16)3/h6-8,14,18H,4-5,9-11,17H2,1-3H3,(H,19,20) |
| InChIKey | XETMUQKANZQNRR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |