C18H24ClN3OS — CID 119670223
N-(4-phenyl-1,3-thiazol-2-yl)-3-piperidin-3-ylbutanamide;hydrochloride (PubChem CID 119670223) has the molecular formula C18H24ClN3OS and a molecular weight of 365.93 g/mol. Its IUPAC name is N-(4-phenyl-1,3-thiazol-2-yl)-3-piperidin-3-ylbutanamide;hydrochloride.
| Compound Name | N-(4-phenyl-1,3-thiazol-2-yl)-3-piperidin-3-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119670223 |
| Molecular Formula | C18H24ClN3OS |
| Molecular Weight | 365.93 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | N-(4-phenyl-1,3-thiazol-2-yl)-3-piperidin-3-ylbutanamide;hydrochloride |
| SMILES | CC(CC(=O)Nc1nc(-c2ccccc2)cs1)C1CCCNC1.Cl |
| InChI | InChI=1S/C18H23N3OS.ClH/c1-13(15-8-5-9-19-11-15)10-17(22)21-18-20-16(12-23-18)14-6-3-2-4-7-14;/h2-4,6-7,12-13,15,19H,5,8-11H2,1H3,(H,20,21,22);1H |
| InChIKey | UQHOJRWVIINVCX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.93 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |