C20H26N4O2S — CID 119676255
N-[4-(4-acetamidophenyl)-1,3-thiazol-2-yl]-3-piperidin-3-ylbutanamide (PubChem CID 119676255) has the molecular formula C20H26N4O2S and a molecular weight of 386.52 g/mol. Its IUPAC name is N-[4-(4-acetamidophenyl)-1,3-thiazol-2-yl]-3-piperidin-3-ylbutanamide.
| Compound Name | N-[4-(4-acetamidophenyl)-1,3-thiazol-2-yl]-3-piperidin-3-ylbutanamide |
|---|---|
| PubChem CID | 119676255 |
| Molecular Formula | C20H26N4O2S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | N-[4-(4-acetamidophenyl)-1,3-thiazol-2-yl]-3-piperidin-3-ylbutanamide |
| SMILES | CC(=O)Nc1ccc(-c2csc(NC(=O)CC(C)C3CCCNC3)n2)cc1 |
| InChI | InChI=1S/C20H26N4O2S/c1-13(16-4-3-9-21-11-16)10-19(26)24-20-23-18(12-27-20)15-5-7-17(8-6-15)22-14(2)25/h5-8,12-13,16,21H,3-4,9-11H2,1-2H3,(H,22,25)(H,23,24,26) |
| InChIKey | VJQJDJDARVNOOM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |