C13H17ClN2O2 — CID 119673083
2,3-dihydroindol-1-yl(morpholin-3-yl)methanone;hydrochloride (PubChem CID 119673083) has the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. Its IUPAC name is 2,3-dihydroindol-1-yl(morpholin-3-yl)methanone;hydrochloride.
| Compound Name | 2,3-dihydroindol-1-yl(morpholin-3-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119673083 |
| Molecular Formula | C13H17ClN2O2 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 2,3-dihydroindol-1-yl(morpholin-3-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(C1COCCN1)N1CCc2ccccc21 |
| InChI | InChI=1S/C13H16N2O2.ClH/c16-13(11-9-17-8-6-14-11)15-7-5-10-3-1-2-4-12(10)15;/h1-4,11,14H,5-9H2;1H |
| InChIKey | VMEIGZNZFZWWFL-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |