C18H19N3O — CID 52990007
2,3-dihydroindol-1-yl-(5-phenylpyrazolidin-3-yl)methanone (PubChem CID 52990007) has the molecular formula C18H19N3O and a molecular weight of 293.37 g/mol. Its IUPAC name is 2,3-dihydroindol-1-yl-(5-phenylpyrazolidin-3-yl)methanone.
| Compound Name | 2,3-dihydroindol-1-yl-(5-phenylpyrazolidin-3-yl)methanone |
|---|---|
| PubChem CID | 52990007 |
| Molecular Formula | C18H19N3O |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 2,3-dihydroindol-1-yl-(5-phenylpyrazolidin-3-yl)methanone |
| SMILES | O=C(C1CC(c2ccccc2)NN1)N1CCc2ccccc21 |
| InChI | InChI=1S/C18H19N3O/c22-18(21-11-10-14-8-4-5-9-17(14)21)16-12-15(19-20-16)13-6-2-1-3-7-13/h1-9,15-16,19-20H,10-12H2 |
| InChIKey | QSQNLHJMZYQBBX-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |