C19H22N2O — CID 119674447
3-amino-2-phenyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)propanamide (PubChem CID 119674447) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is 3-amino-2-phenyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)propanamide.
| Compound Name | 3-amino-2-phenyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)propanamide |
|---|---|
| PubChem CID | 119674447 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 3-amino-2-phenyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)propanamide |
| SMILES | NCC(C(=O)NC1CCCc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C19H22N2O/c20-13-17(15-7-2-1-3-8-15)19(22)21-18-12-6-10-14-9-4-5-11-16(14)18/h1-5,7-9,11,17-18H,6,10,12-13,20H2,(H,21,22) |
| InChIKey | CRQUADJLMPWDEI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |