C18H31ClN2O2 — CID 119675308
N-[1-(1-adamantyl)ethyl]-2-morpholin-2-ylacetamide;hydrochloride (PubChem CID 119675308) has the molecular formula C18H31ClN2O2 and a molecular weight of 342.91 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethyl]-2-morpholin-2-ylacetamide;hydrochloride.
| Compound Name | N-[1-(1-adamantyl)ethyl]-2-morpholin-2-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119675308 |
| Molecular Formula | C18H31ClN2O2 |
| Molecular Weight | 342.91 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | N-[1-(1-adamantyl)ethyl]-2-morpholin-2-ylacetamide;hydrochloride |
| SMILES | CC(NC(=O)CC1CNCCO1)C12CC3CC(CC(C3)C1)C2.Cl |
| InChI | InChI=1S/C18H30N2O2.ClH/c1-12(20-17(21)7-16-11-19-2-3-22-16)18-8-13-4-14(9-18)6-15(5-13)10-18;/h12-16,19H,2-11H2,1H3,(H,20,21);1H |
| InChIKey | BAYVWYOGSGGSDT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.91 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |