C20H27N3OS — CID 119681420
N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]-3-piperidin-4-ylbutanamide (PubChem CID 119681420) has the molecular formula C20H27N3OS and a molecular weight of 357.52 g/mol. Its IUPAC name is N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]-3-piperidin-4-ylbutanamide.
| Compound Name | N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]-3-piperidin-4-ylbutanamide |
|---|---|
| PubChem CID | 119681420 |
| Molecular Formula | C20H27N3OS |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]-3-piperidin-4-ylbutanamide |
| SMILES | CC(CC(=O)NCCc1csc(-c2ccccc2)n1)C1CCNCC1 |
| InChI | InChI=1S/C20H27N3OS/c1-15(16-7-10-21-11-8-16)13-19(24)22-12-9-18-14-25-20(23-18)17-5-3-2-4-6-17/h2-6,14-16,21H,7-13H2,1H3,(H,22,24) |
| InChIKey | JXROMDYJFVZQRJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |