C17H23N3O2S — CID 119813700
N-[[2-(furan-2-yl)-1,3-thiazol-4-yl]methyl]-3-piperidin-4-ylbutanamide (PubChem CID 119813700) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is N-[[2-(furan-2-yl)-1,3-thiazol-4-yl]methyl]-3-piperidin-4-ylbutanamide.
| Compound Name | N-[[2-(furan-2-yl)-1,3-thiazol-4-yl]methyl]-3-piperidin-4-ylbutanamide |
|---|---|
| PubChem CID | 119813700 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | N-[[2-(furan-2-yl)-1,3-thiazol-4-yl]methyl]-3-piperidin-4-ylbutanamide |
| SMILES | CC(CC(=O)NCc1csc(-c2ccco2)n1)C1CCNCC1 |
| InChI | InChI=1S/C17H23N3O2S/c1-12(13-4-6-18-7-5-13)9-16(21)19-10-14-11-23-17(20-14)15-3-2-8-22-15/h2-3,8,11-13,18H,4-7,9-10H2,1H3,(H,19,21) |
| InChIKey | IPYHNEJXHUAVJA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |