C22H29N3O2 — CID 119682383
3-amino-2-methyl-N-[2-(2-methylanilino)-2-oxoethyl]-3-phenyl-N-propylpropanamide (PubChem CID 119682383) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is 3-amino-2-methyl-N-[2-(2-methylanilino)-2-oxoethyl]-3-phenyl-N-propylpropanamide.
| Compound Name | 3-amino-2-methyl-N-[2-(2-methylanilino)-2-oxoethyl]-3-phenyl-N-propylpropanamide |
|---|---|
| PubChem CID | 119682383 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 3-amino-2-methyl-N-[2-(2-methylanilino)-2-oxoethyl]-3-phenyl-N-propylpropanamide |
| SMILES | CCCN(CC(=O)Nc1ccccc1C)C(=O)C(C)C(N)c1ccccc1 |
| InChI | InChI=1S/C22H29N3O2/c1-4-14-25(15-20(26)24-19-13-9-8-10-16(19)2)22(27)17(3)21(23)18-11-6-5-7-12-18/h5-13,17,21H,4,14-15,23H2,1-3H3,(H,24,26) |
| InChIKey | WIDOQECTTVPDIK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |