C20H25N3O4 — CID 51143508
N-[1-[[2-(2-methylanilino)-2-oxoethyl]-propylamino]-1-oxopropan-2-yl]furan-2-carboxamide (PubChem CID 51143508) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is N-[1-[[2-(2-methylanilino)-2-oxoethyl]-propylamino]-1-oxopropan-2-yl]furan-2-carboxamide.
| Compound Name | N-[1-[[2-(2-methylanilino)-2-oxoethyl]-propylamino]-1-oxopropan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 51143508 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | N-[1-[[2-(2-methylanilino)-2-oxoethyl]-propylamino]-1-oxopropan-2-yl]furan-2-carboxamide |
| SMILES | CCCN(CC(=O)Nc1ccccc1C)C(=O)C(C)NC(=O)c1ccco1 |
| InChI | InChI=1S/C20H25N3O4/c1-4-11-23(13-18(24)22-16-9-6-5-8-14(16)2)20(26)15(3)21-19(25)17-10-7-12-27-17/h5-10,12,15H,4,11,13H2,1-3H3,(H,21,25)(H,22,24) |
| InChIKey | RSOVEOSGZRDQTI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |