C15H22N2O5 — CID 129414649
3-[[(2S)-2-(furan-2-carbonylamino)propanoyl]-(2-methylpropyl)amino]propanoic acid (PubChem CID 129414649) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is 3-[[(2S)-2-(furan-2-carbonylamino)propanoyl]-(2-methylpropyl)amino]propanoic acid.
| Compound Name | 3-[[(2S)-2-(furan-2-carbonylamino)propanoyl]-(2-methylpropyl)amino]propanoic acid |
|---|---|
| PubChem CID | 129414649 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 3-[[(2S)-2-(furan-2-carbonylamino)propanoyl]-(2-methylpropyl)amino]propanoic acid |
| SMILES | CC(C)CN(CCC(=O)O)C(=O)[C@H](C)NC(=O)c1ccco1 |
| InChI | InChI=1S/C15H22N2O5/c1-10(2)9-17(7-6-13(18)19)15(21)11(3)16-14(20)12-5-4-8-22-12/h4-5,8,10-11H,6-7,9H2,1-3H3,(H,16,20)(H,18,19)/t11-/m0/s1 |
| InChIKey | PIAWIEPFHYUCQH-NSHDSACASA-N |
| XLogP | 1.36 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |