C17H32N2O3S — CID 119682490
N-butyl-N-(1,1-dioxothiolan-3-yl)-3-piperidin-3-ylbutanamide (PubChem CID 119682490) has the molecular formula C17H32N2O3S and a molecular weight of 344.52 g/mol. Its IUPAC name is N-butyl-N-(1,1-dioxothiolan-3-yl)-3-piperidin-3-ylbutanamide.
| Compound Name | N-butyl-N-(1,1-dioxothiolan-3-yl)-3-piperidin-3-ylbutanamide |
|---|---|
| PubChem CID | 119682490 |
| Molecular Formula | C17H32N2O3S |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | N-butyl-N-(1,1-dioxothiolan-3-yl)-3-piperidin-3-ylbutanamide |
| SMILES | CCCCN(C(=O)CC(C)C1CCCNC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H32N2O3S/c1-3-4-9-19(16-7-10-23(21,22)13-16)17(20)11-14(2)15-6-5-8-18-12-15/h14-16,18H,3-13H2,1-2H3 |
| InChIKey | KDSXJEXAECJSCE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |