C16H30N2O3S — CID 119683492
N-(1,1-dioxothiolan-3-yl)-3-piperidin-3-yl-N-propylbutanamide (PubChem CID 119683492) has the molecular formula C16H30N2O3S and a molecular weight of 330.49 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-piperidin-3-yl-N-propylbutanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-piperidin-3-yl-N-propylbutanamide |
|---|---|
| PubChem CID | 119683492 |
| Molecular Formula | C16H30N2O3S |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-piperidin-3-yl-N-propylbutanamide |
| SMILES | CCCN(C(=O)CC(C)C1CCCNC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H30N2O3S/c1-3-8-18(15-6-9-22(20,21)12-15)16(19)10-13(2)14-5-4-7-17-11-14/h13-15,17H,3-12H2,1-2H3 |
| InChIKey | VMDXFYSNRVYMLY-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |