C14H26N2O3S — CID 63638478
2-(1,1-dioxothiolan-3-yl)-N-piperidin-3-yl-N-propylacetamide (PubChem CID 63638478) has the molecular formula C14H26N2O3S and a molecular weight of 302.44 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-N-piperidin-3-yl-N-propylacetamide.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-N-piperidin-3-yl-N-propylacetamide |
|---|---|
| PubChem CID | 63638478 |
| Molecular Formula | C14H26N2O3S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-N-piperidin-3-yl-N-propylacetamide |
| SMILES | CCCN(C(=O)CC1CCS(=O)(=O)C1)C1CCCNC1 |
| InChI | InChI=1S/C14H26N2O3S/c1-2-7-16(13-4-3-6-15-10-13)14(17)9-12-5-8-20(18,19)11-12/h12-13,15H,2-11H2,1H3 |
| InChIKey | ZXMSNNWZGPHVDL-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |