C18H23N3O2S — CID 119686515
N-[4-(4-butylphenyl)-1,3-thiazol-2-yl]-4-hydroxypyrrolidine-2-carboxamide (PubChem CID 119686515) has the molecular formula C18H23N3O2S and a molecular weight of 345.47 g/mol. Its IUPAC name is N-[4-(4-butylphenyl)-1,3-thiazol-2-yl]-4-hydroxypyrrolidine-2-carboxamide.
| Compound Name | N-[4-(4-butylphenyl)-1,3-thiazol-2-yl]-4-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 119686515 |
| Molecular Formula | C18H23N3O2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | N-[4-(4-butylphenyl)-1,3-thiazol-2-yl]-4-hydroxypyrrolidine-2-carboxamide |
| SMILES | CCCCc1ccc(-c2csc(NC(=O)C3CC(O)CN3)n2)cc1 |
| InChI | InChI=1S/C18H23N3O2S/c1-2-3-4-12-5-7-13(8-6-12)16-11-24-18(20-16)21-17(23)15-9-14(22)10-19-15/h5-8,11,14-15,19,22H,2-4,9-10H2,1H3,(H,20,21,23) |
| InChIKey | GNQSKDZSEOVOIL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |