C20H27N3O2S — CID 119686519
N-[4-(4-butylphenyl)-1,3-thiazol-2-yl]-4-methoxypiperidine-4-carboxamide (PubChem CID 119686519) has the molecular formula C20H27N3O2S and a molecular weight of 373.52 g/mol. Its IUPAC name is N-[4-(4-butylphenyl)-1,3-thiazol-2-yl]-4-methoxypiperidine-4-carboxamide.
| Compound Name | N-[4-(4-butylphenyl)-1,3-thiazol-2-yl]-4-methoxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 119686519 |
| Molecular Formula | C20H27N3O2S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | N-[4-(4-butylphenyl)-1,3-thiazol-2-yl]-4-methoxypiperidine-4-carboxamide |
| SMILES | CCCCc1ccc(-c2csc(NC(=O)C3(OC)CCNCC3)n2)cc1 |
| InChI | InChI=1S/C20H27N3O2S/c1-3-4-5-15-6-8-16(9-7-15)17-14-26-19(22-17)23-18(24)20(25-2)10-12-21-13-11-20/h6-9,14,21H,3-5,10-13H2,1-2H3,(H,22,23,24) |
| InChIKey | HCVCYHAVDBBAAA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |