C20H32N2O3 — CID 119688640
3-amino-N-[1-(3,4-dipropoxyphenyl)ethyl]cyclopentane-1-carboxamide (PubChem CID 119688640) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is 3-amino-N-[1-(3,4-dipropoxyphenyl)ethyl]cyclopentane-1-carboxamide.
| Compound Name | 3-amino-N-[1-(3,4-dipropoxyphenyl)ethyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 119688640 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | 3-amino-N-[1-(3,4-dipropoxyphenyl)ethyl]cyclopentane-1-carboxamide |
| SMILES | CCCOc1ccc(C(C)NC(=O)C2CCC(N)C2)cc1OCCC |
| InChI | InChI=1S/C20H32N2O3/c1-4-10-24-18-9-7-15(13-19(18)25-11-5-2)14(3)22-20(23)16-6-8-17(21)12-16/h7,9,13-14,16-17H,4-6,8,10-12,21H2,1-3H3,(H,22,23) |
| InChIKey | DKUFOXITWUWNHU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |