C21H34N2O3 — CID 119688642
3-amino-N-[1-(3,4-dipropoxyphenyl)ethyl]cyclohexane-1-carboxamide (PubChem CID 119688642) has the molecular formula C21H34N2O3 and a molecular weight of 362.51 g/mol. Its IUPAC name is 3-amino-N-[1-(3,4-dipropoxyphenyl)ethyl]cyclohexane-1-carboxamide.
| Compound Name | 3-amino-N-[1-(3,4-dipropoxyphenyl)ethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 119688642 |
| Molecular Formula | C21H34N2O3 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | 3-amino-N-[1-(3,4-dipropoxyphenyl)ethyl]cyclohexane-1-carboxamide |
| SMILES | CCCOc1ccc(C(C)NC(=O)C2CCCC(N)C2)cc1OCCC |
| InChI | InChI=1S/C21H34N2O3/c1-4-11-25-19-10-9-16(14-20(19)26-12-5-2)15(3)23-21(24)17-7-6-8-18(22)13-17/h9-10,14-15,17-18H,4-8,11-13,22H2,1-3H3,(H,23,24) |
| InChIKey | YSZWYAUJVFAXDI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |