C16H25N3O4S — CID 119690147
2-methyl-3-(methylamino)-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]propanamide (PubChem CID 119690147) has the molecular formula C16H25N3O4S and a molecular weight of 355.46 g/mol. Its IUPAC name is 2-methyl-3-(methylamino)-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]propanamide.
| Compound Name | 2-methyl-3-(methylamino)-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 119690147 |
| Molecular Formula | C16H25N3O4S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 2-methyl-3-(methylamino)-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]propanamide |
| SMILES | CNCC(C)C(=O)NCc1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C16H25N3O4S/c1-13(11-17-2)16(20)18-12-14-3-5-15(6-4-14)24(21,22)19-7-9-23-10-8-19/h3-6,13,17H,7-12H2,1-2H3,(H,18,20) |
| InChIKey | RGXGUZZIWTXITO-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |