C17H25N3O2S — CID 119691926
N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-3-piperidin-3-ylbutanamide (PubChem CID 119691926) has the molecular formula C17H25N3O2S and a molecular weight of 335.47 g/mol. Its IUPAC name is N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-3-piperidin-3-ylbutanamide.
| Compound Name | N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-3-piperidin-3-ylbutanamide |
|---|---|
| PubChem CID | 119691926 |
| Molecular Formula | C17H25N3O2S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-3-piperidin-3-ylbutanamide |
| SMILES | CC(CC(=O)Nc1ccccc1SCC(N)=O)C1CCCNC1 |
| InChI | InChI=1S/C17H25N3O2S/c1-12(13-5-4-8-19-10-13)9-17(22)20-14-6-2-3-7-15(14)23-11-16(18)21/h2-3,6-7,12-13,19H,4-5,8-11H2,1H3,(H2,18,21)(H,20,22) |
| InChIKey | JUGLATRXFPSVGC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |