C13H18ClN3O2S — CID 119691939
N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]pyrrolidine-3-carboxamide;hydrochloride (PubChem CID 119691939) has the molecular formula C13H18ClN3O2S and a molecular weight of 315.83 g/mol. Its IUPAC name is N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]pyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]pyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119691939 |
| Molecular Formula | C13H18ClN3O2S |
| Molecular Weight | 315.83 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]pyrrolidine-3-carboxamide;hydrochloride |
| SMILES | Cl.NC(=O)CSc1ccccc1NC(=O)C1CCNC1 |
| InChI | InChI=1S/C13H17N3O2S.ClH/c14-12(17)8-19-11-4-2-1-3-10(11)16-13(18)9-5-6-15-7-9;/h1-4,9,15H,5-8H2,(H2,14,17)(H,16,18);1H |
| InChIKey | YHFSFXWWLKGPLZ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.83 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |