C16H22ClN3O4 — CID 119692977
methyl 2-[[4-[(2-pyrrolidin-2-ylacetyl)amino]benzoyl]amino]acetate;hydrochloride (PubChem CID 119692977) has the molecular formula C16H22ClN3O4 and a molecular weight of 355.82 g/mol. Its IUPAC name is methyl 2-[[4-[(2-pyrrolidin-2-ylacetyl)amino]benzoyl]amino]acetate;hydrochloride.
| Compound Name | methyl 2-[[4-[(2-pyrrolidin-2-ylacetyl)amino]benzoyl]amino]acetate;hydrochloride |
|---|---|
| PubChem CID | 119692977 |
| Molecular Formula | C16H22ClN3O4 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | methyl 2-[[4-[(2-pyrrolidin-2-ylacetyl)amino]benzoyl]amino]acetate;hydrochloride |
| SMILES | COC(=O)CNC(=O)c1ccc(NC(=O)CC2CCCN2)cc1.Cl |
| InChI | InChI=1S/C16H21N3O4.ClH/c1-23-15(21)10-18-16(22)11-4-6-12(7-5-11)19-14(20)9-13-3-2-8-17-13;/h4-7,13,17H,2-3,8-10H2,1H3,(H,18,22)(H,19,20);1H |
| InChIKey | MBCLORQJXAQRRG-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |