C19H25N3O2 — CID 119739199
N,N-bis(prop-2-enyl)-4-[(2-pyrrolidin-2-ylacetyl)amino]benzamide (PubChem CID 119739199) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is N,N-bis(prop-2-enyl)-4-[(2-pyrrolidin-2-ylacetyl)amino]benzamide.
| Compound Name | N,N-bis(prop-2-enyl)-4-[(2-pyrrolidin-2-ylacetyl)amino]benzamide |
|---|---|
| PubChem CID | 119739199 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | N,N-bis(prop-2-enyl)-4-[(2-pyrrolidin-2-ylacetyl)amino]benzamide |
| SMILES | C=CCN(CC=C)C(=O)c1ccc(NC(=O)CC2CCCN2)cc1 |
| InChI | InChI=1S/C19H25N3O2/c1-3-12-22(13-4-2)19(24)15-7-9-16(10-8-15)21-18(23)14-17-6-5-11-20-17/h3-4,7-10,17,20H,1-2,5-6,11-14H2,(H,21,23) |
| InChIKey | WBLIIYRUQAGZOF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|