C14H20ClN3O4 — CID 119694637
2-(2-methoxyethylamino)-N-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)acetamide;hydrochloride (PubChem CID 119694637) has the molecular formula C14H20ClN3O4 and a molecular weight of 329.78 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)acetamide;hydrochloride.
| Compound Name | 2-(2-methoxyethylamino)-N-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119694637 |
| Molecular Formula | C14H20ClN3O4 |
| Molecular Weight | 329.78 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)acetamide;hydrochloride |
| SMILES | COCCNCC(=O)Nc1ccc2c(c1)NC(=O)C(C)O2.Cl |
| InChI | InChI=1S/C14H19N3O4.ClH/c1-9-14(19)17-11-7-10(3-4-12(11)21-9)16-13(18)8-15-5-6-20-2;/h3-4,7,9,15H,5-6,8H2,1-2H3,(H,16,18)(H,17,19);1H |
| InChIKey | LIQLGGYYDQMRHB-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.78 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|