C14H20ClFN2O3 — CID 119695324
N-[2-(4-fluorophenoxy)ethyl]-N-methylmorpholine-2-carboxamide;hydrochloride (PubChem CID 119695324) has the molecular formula C14H20ClFN2O3 and a molecular weight of 318.78 g/mol. Its IUPAC name is N-[2-(4-fluorophenoxy)ethyl]-N-methylmorpholine-2-carboxamide;hydrochloride.
| Compound Name | N-[2-(4-fluorophenoxy)ethyl]-N-methylmorpholine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119695324 |
| Molecular Formula | C14H20ClFN2O3 |
| Molecular Weight | 318.78 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | N-[2-(4-fluorophenoxy)ethyl]-N-methylmorpholine-2-carboxamide;hydrochloride |
| SMILES | CN(CCOc1ccc(F)cc1)C(=O)C1CNCCO1.Cl |
| InChI | InChI=1S/C14H19FN2O3.ClH/c1-17(14(18)13-10-16-6-8-20-13)7-9-19-12-4-2-11(15)3-5-12;/h2-5,13,16H,6-10H2,1H3;1H |
| InChIKey | SWZDNQFUVPSXDU-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.78 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |