C16H23FN2O4 — CID 119779586
N-[2-(4-fluorophenoxy)ethyl]-N-(2-methoxyethyl)morpholine-2-carboxamide (PubChem CID 119779586) has the molecular formula C16H23FN2O4 and a molecular weight of 326.37 g/mol. Its IUPAC name is N-[2-(4-fluorophenoxy)ethyl]-N-(2-methoxyethyl)morpholine-2-carboxamide.
| Compound Name | N-[2-(4-fluorophenoxy)ethyl]-N-(2-methoxyethyl)morpholine-2-carboxamide |
|---|---|
| PubChem CID | 119779586 |
| Molecular Formula | C16H23FN2O4 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | N-[2-(4-fluorophenoxy)ethyl]-N-(2-methoxyethyl)morpholine-2-carboxamide |
| SMILES | COCCN(CCOc1ccc(F)cc1)C(=O)C1CNCCO1 |
| InChI | InChI=1S/C16H23FN2O4/c1-21-10-7-19(16(20)15-12-18-6-9-23-15)8-11-22-14-4-2-13(17)3-5-14/h2-5,15,18H,6-12H2,1H3 |
| InChIKey | XYCKZABEZKZVMZ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |